C15H17FN2O2 — CID 133149974
5-(4-fluorophenyl)-N-pentan-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 133149974) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-pentan-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-pentan-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 133149974 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 5-(4-fluorophenyl)-N-pentan-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | CCCC(C)NC(=O)c1cc(-c2ccc(F)cc2)on1 |
| InChI | InChI=1S/C15H17FN2O2/c1-3-4-10(2)17-15(19)13-9-14(20-18-13)11-5-7-12(16)8-6-11/h5-10H,3-4H2,1-2H3,(H,17,19) |
| InChIKey | OXSMJPXISMCIRC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |