C22H26BrClN2O3 — CID 133151712
2-[(3-bromophenyl)methyl-[2-(3-chlorophenoxy)acetyl]amino]-N-butylpropanamide (PubChem CID 133151712) has the molecular formula C22H26BrClN2O3 and a molecular weight of 481.82 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(3-chlorophenoxy)acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(3-chlorophenoxy)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133151712 |
| Molecular Formula | C22H26BrClN2O3 |
| Molecular Weight | 481.82 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(3-chlorophenoxy)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H26BrClN2O3/c1-3-4-11-25-22(28)16(2)26(14-17-7-5-8-18(23)12-17)21(27)15-29-20-10-6-9-19(24)13-20/h5-10,12-13,16H,3-4,11,14-15H2,1-2H3,(H,25,28) |
| InChIKey | CHGNQFPLQMQCSR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.82 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|