C23H28BrClN2O2S — CID 133152084
2-[(4-bromophenyl)methyl-[2-[(2-chlorophenyl)methylsulfanyl]acetyl]amino]-N-butylpropanamide (PubChem CID 133152084) has the molecular formula C23H28BrClN2O2S and a molecular weight of 511.91 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-[(2-chlorophenyl)methylsulfanyl]acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-[(2-chlorophenyl)methylsulfanyl]acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133152084 |
| Molecular Formula | C23H28BrClN2O2S |
| Molecular Weight | 511.91 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-[(2-chlorophenyl)methylsulfanyl]acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)CSCc1ccccc1Cl |
| InChI | InChI=1S/C23H28BrClN2O2S/c1-3-4-13-26-23(29)17(2)27(14-18-9-11-20(24)12-10-18)22(28)16-30-15-19-7-5-6-8-21(19)25/h5-12,17H,3-4,13-16H2,1-2H3,(H,26,29) |
| InChIKey | ZGAOKUBPIFRFFL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.91 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|