C30H33BrFN3O6S — CID 133152254
2-[(4-bromophenyl)methyl-[2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetyl]amino]-N-butylpropanamide (PubChem CID 133152254) has the molecular formula C30H33BrFN3O6S and a molecular weight of 662.58 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133152254 |
| Molecular Formula | C30H33BrFN3O6S |
| Molecular Weight | 662.58 g/mol |
| Exact Mass | 661.13 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Br)cc1)C(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C30H33BrFN3O6S/c1-3-4-15-33-30(37)21(2)34(19-22-5-7-23(31)8-6-22)29(36)20-35(25-11-9-24(32)10-12-25)42(38,39)26-13-14-27-28(18-26)41-17-16-40-27/h5-14,18,21H,3-4,15-17,19-20H2,1-2H3,(H,33,37) |
| InChIKey | BLKLZDXIDLMVFH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|