C34H35Cl2N3O4S — CID 133152442
2-[[2-[N-(benzenesulfonyl)-3,5-dichloroanilino]acetyl]-benzylamino]-N-butyl-3-phenylpropanamide (PubChem CID 133152442) has the molecular formula C34H35Cl2N3O4S and a molecular weight of 652.64 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3,5-dichloroanilino]acetyl]-benzylamino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3,5-dichloroanilino]acetyl]-benzylamino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133152442 |
| Molecular Formula | C34H35Cl2N3O4S |
| Molecular Weight | 652.64 g/mol |
| Exact Mass | 651.17 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3,5-dichloroanilino]acetyl]-benzylamino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CN(c1cc(Cl)cc(Cl)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H35Cl2N3O4S/c1-2-3-19-37-34(41)32(20-26-13-7-4-8-14-26)38(24-27-15-9-5-10-16-27)33(40)25-39(30-22-28(35)21-29(36)23-30)44(42,43)31-17-11-6-12-18-31/h4-18,21-23,32H,2-3,19-20,24-25H2,1H3,(H,37,41) |
| InChIKey | ICGBWJWLILNDEH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|