C30H38N4O4S — CID 133152604
2-[benzyl-[2-[N-(dimethylsulfamoyl)anilino]acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133152604) has the molecular formula C30H38N4O4S and a molecular weight of 550.73 g/mol. Its IUPAC name is 2-[benzyl-[2-[N-(dimethylsulfamoyl)anilino]acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[benzyl-[2-[N-(dimethylsulfamoyl)anilino]acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133152604 |
| Molecular Formula | C30H38N4O4S |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 2-[benzyl-[2-[N-(dimethylsulfamoyl)anilino]acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CN(c1ccccc1)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C30H38N4O4S/c1-4-5-21-31-30(36)28(22-25-15-9-6-10-16-25)33(23-26-17-11-7-12-18-26)29(35)24-34(39(37,38)32(2)3)27-19-13-8-14-20-27/h6-20,28H,4-5,21-24H2,1-3H3,(H,31,36) |
| InChIKey | MPVKIGNCQAHMFS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|