C31H36F3N3O4S — CID 133153201
N-butyl-2-[(3-methylphenyl)methyl-[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]-3-phenylpropanamide (PubChem CID 133153201) has the molecular formula C31H36F3N3O4S and a molecular weight of 603.71 g/mol. Its IUPAC name is N-butyl-2-[(3-methylphenyl)methyl-[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(3-methylphenyl)methyl-[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133153201 |
| Molecular Formula | C31H36F3N3O4S |
| Molecular Weight | 603.71 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | N-butyl-2-[(3-methylphenyl)methyl-[2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)CN(c1cccc(C(F)(F)F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C31H36F3N3O4S/c1-4-5-17-35-30(39)28(19-24-12-7-6-8-13-24)36(21-25-14-9-11-23(2)18-25)29(38)22-37(42(3,40)41)27-16-10-15-26(20-27)31(32,33)34/h6-16,18,20,28H,4-5,17,19,21-22H2,1-3H3,(H,35,39) |
| InChIKey | WYDJVYIYUIXLFY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|