C26H28BrClN2O3 — CID 133154192
2-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide (PubChem CID 133154192) has the molecular formula C26H28BrClN2O3 and a molecular weight of 531.88 g/mol. Its IUPAC name is 2-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | 2-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133154192 |
| Molecular Formula | C26H28BrClN2O3 |
| Molecular Weight | 531.88 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | 2-[[2-(1-bromonaphthalen-2-yl)oxyacetyl]-[(3-chlorophenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Cl)c1)C(=O)COc1ccc2ccccc2c1Br |
| InChI | InChI=1S/C26H28BrClN2O3/c1-3-4-14-29-26(32)18(2)30(16-19-8-7-10-21(28)15-19)24(31)17-33-23-13-12-20-9-5-6-11-22(20)25(23)27/h5-13,15,18H,3-4,14,16-17H2,1-2H3,(H,29,32) |
| InChIKey | WNGXXCVCOFQGSG-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.88 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|