C28H26Cl2N4O2S — CID 133157243
1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-[1-(4-chloro-3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157243) has the molecular formula C28H26Cl2N4O2S and a molecular weight of 553.52 g/mol. Its IUPAC name is 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-[1-(4-chloro-3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-[1-(4-chloro-3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157243 |
| Molecular Formula | C28H26Cl2N4O2S |
| Molecular Weight | 553.52 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-5-[1-(4-chloro-3-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COCCOc1ccc(N2C(=S)NC(c3ccccn3)C2c2cccn2-c2ccc(Cl)c(C)c2)cc1Cl |
| InChI | InChI=1S/C28H26Cl2N4O2S/c1-18-16-19(8-10-21(18)29)33-13-5-7-24(33)27-26(23-6-3-4-12-31-23)32-28(37)34(27)20-9-11-25(22(30)17-20)36-15-14-35-2/h3-13,16-17,26-27H,14-15H2,1-2H3,(H,32,37) |
| InChIKey | NIJUYYCEEGQIGW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|