C28H28N4S — CID 133157847
5-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1-(4-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133157847) has the molecular formula C28H28N4S and a molecular weight of 452.63 g/mol. Its IUPAC name is 5-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1-(4-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1-(4-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133157847 |
| Molecular Formula | C28H28N4S |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 5-(1-benzyl-2,5-dimethylpyrrol-3-yl)-1-(4-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc(C)n(Cc3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C28H28N4S/c1-19-12-14-23(15-13-19)32-27(26(30-28(32)33)25-11-7-8-16-29-25)24-17-20(2)31(21(24)3)18-22-9-5-4-6-10-22/h4-17,26-27H,18H2,1-3H3,(H,30,33) |
| InChIKey | JKQGTZLYGUAWCG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|