C15H22N2O3S2 — CID 133161258
N-[5-(3-methylpiperidin-1-yl)sulfonyl-2-methylsulfanylphenyl]acetamide (PubChem CID 133161258) has the molecular formula C15H22N2O3S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is N-[5-(3-methylpiperidin-1-yl)sulfonyl-2-methylsulfanylphenyl]acetamide.
| Compound Name | N-[5-(3-methylpiperidin-1-yl)sulfonyl-2-methylsulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 133161258 |
| Molecular Formula | C15H22N2O3S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N-[5-(3-methylpiperidin-1-yl)sulfonyl-2-methylsulfanylphenyl]acetamide |
| SMILES | CSc1ccc(S(=O)(=O)N2CCCC(C)C2)cc1NC(C)=O |
| InChI | InChI=1S/C15H22N2O3S2/c1-11-5-4-8-17(10-11)22(19,20)13-6-7-15(21-3)14(9-13)16-12(2)18/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,16,18) |
| InChIKey | ZAQMVQUMBJLEBF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |