C21H23N3O2S2 — CID 133161728
N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,3,5-trimethylphenoxy)propanamide (PubChem CID 133161728) has the molecular formula C21H23N3O2S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,3,5-trimethylphenoxy)propanamide.
| Compound Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,3,5-trimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 133161728 |
| Molecular Formula | C21H23N3O2S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(2,3,5-trimethylphenoxy)propanamide |
| SMILES | Cc1cc(C)c(C)c(OC(C)C(=O)Nc2nnc(SCc3ccccc3)s2)c1 |
| InChI | InChI=1S/C21H23N3O2S2/c1-13-10-14(2)15(3)18(11-13)26-16(4)19(25)22-20-23-24-21(28-20)27-12-17-8-6-5-7-9-17/h5-11,16H,12H2,1-4H3,(H,22,23,25) |
| InChIKey | OPWIMWQHSGYWGQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|