About N-tert-butyl-2,2-dimethylheptan-3-amine
N-tert-butyl-2,2-dimethylheptan-3-amine (PubChem CID 13316188) has the molecular formula C13H29N
and a molecular weight of 199.38 g/mol. Its IUPAC name is N-tert-butyl-2,2-dimethylheptan-3-amine.
Molecular Properties
| Compound Name | N-tert-butyl-2,2-dimethylheptan-3-amine |
| PubChem CID | 13316188 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | N-tert-butyl-2,2-dimethylheptan-3-amine |
| SMILES | CCCCC(NC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H29N/c1-8-9-10-11(12(2,3)4)14-13(5,6)7/h11,14H,8-10H2,1-7H3 |
| InChIKey | YDSOGFBCGJCWFG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-2,2-dimethylheptan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,2-dimethylheptan-3-amine?
The IUPAC name of N-tert-butyl-2,2-dimethylheptan-3-amine (CID 13316188) is N-tert-butyl-2,2-dimethylheptan-3-amine.
What is the SMILES notation for N-tert-butyl-2,2-dimethylheptan-3-amine?
The canonical SMILES for N-tert-butyl-2,2-dimethylheptan-3-amine is CCCCC(NC(C)(C)C)C(C)(C)C.
What is the InChIKey of N-tert-butyl-2,2-dimethylheptan-3-amine?
The InChIKey is YDSOGFBCGJCWFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N/c1-8-9-10-11(12(2,3)4)14-13(5,6)7/h11,14H,8-10H2,1-7H3.
What are the key properties of N-tert-butyl-2,2-dimethylheptan-3-amine?
N-tert-butyl-2,2-dimethylheptan-3-amine has a molecular weight of 199.38 g/mol, XLogP of 3.98, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,2-dimethylheptan-3-amine is sourced from PubChem (CID 13316188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).