C21H24ClFN2O4S — CID 133163562
1-(5-chloro-2-ethoxyphenyl)sulfonyl-N-(4-fluorophenyl)-N-methylpiperidine-3-carboxamide (PubChem CID 133163562) has the molecular formula C21H24ClFN2O4S and a molecular weight of 454.95 g/mol. Its IUPAC name is 1-(5-chloro-2-ethoxyphenyl)sulfonyl-N-(4-fluorophenyl)-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-(5-chloro-2-ethoxyphenyl)sulfonyl-N-(4-fluorophenyl)-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 133163562 |
| Molecular Formula | C21H24ClFN2O4S |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 1-(5-chloro-2-ethoxyphenyl)sulfonyl-N-(4-fluorophenyl)-N-methylpiperidine-3-carboxamide |
| SMILES | CCOc1ccc(Cl)cc1S(=O)(=O)N1CCCC(C(=O)N(C)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H24ClFN2O4S/c1-3-29-19-11-6-16(22)13-20(19)30(27,28)25-12-4-5-15(14-25)21(26)24(2)18-9-7-17(23)8-10-18/h6-11,13,15H,3-5,12,14H2,1-2H3 |
| InChIKey | JNLZQPLAAKCEJI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |