C19H31NO3 — CID 133164242
2-(4-methoxyphenoxy)-N-(2,4,4-trimethylpentan-2-yl)butanamide (PubChem CID 133164242) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-(2,4,4-trimethylpentan-2-yl)butanamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-(2,4,4-trimethylpentan-2-yl)butanamide |
|---|---|
| PubChem CID | 133164242 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-(2,4,4-trimethylpentan-2-yl)butanamide |
| SMILES | CCC(Oc1ccc(OC)cc1)C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C19H31NO3/c1-8-16(23-15-11-9-14(22-7)10-12-15)17(21)20-19(5,6)13-18(2,3)4/h9-12,16H,8,13H2,1-7H3,(H,20,21) |
| InChIKey | LVDLNGHNYVMGDG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |