C24H34N2O4S — CID 133165331
2-(2,5-dimethyl-N-methylsulfonylanilino)-N-[2-(2-propan-2-ylphenoxy)ethyl]butanamide (PubChem CID 133165331) has the molecular formula C24H34N2O4S and a molecular weight of 446.61 g/mol. Its IUPAC name is 2-(2,5-dimethyl-N-methylsulfonylanilino)-N-[2-(2-propan-2-ylphenoxy)ethyl]butanamide.
| Compound Name | 2-(2,5-dimethyl-N-methylsulfonylanilino)-N-[2-(2-propan-2-ylphenoxy)ethyl]butanamide |
|---|---|
| PubChem CID | 133165331 |
| Molecular Formula | C24H34N2O4S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 2-(2,5-dimethyl-N-methylsulfonylanilino)-N-[2-(2-propan-2-ylphenoxy)ethyl]butanamide |
| SMILES | CCC(C(=O)NCCOc1ccccc1C(C)C)N(c1cc(C)ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C24H34N2O4S/c1-7-21(26(31(6,28)29)22-16-18(4)12-13-19(22)5)24(27)25-14-15-30-23-11-9-8-10-20(23)17(2)3/h8-13,16-17,21H,7,14-15H2,1-6H3,(H,25,27) |
| InChIKey | AFHAYCZNQLIWAZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|