C20H26N2O5S2 — CID 133165715
2-(3-methyl-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]propanamide (PubChem CID 133165715) has the molecular formula C20H26N2O5S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-(3-methyl-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]propanamide.
| Compound Name | 2-(3-methyl-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 133165715 |
| Molecular Formula | C20H26N2O5S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-(3-methyl-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]propanamide |
| SMILES | Cc1cccc(N(C(C)C(=O)NC(C)c2ccc(S(C)(=O)=O)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H26N2O5S2/c1-14-7-6-8-18(13-14)22(29(5,26)27)16(3)20(23)21-15(2)17-9-11-19(12-10-17)28(4,24)25/h6-13,15-16H,1-5H3,(H,21,23) |
| InChIKey | NUEMKZYXTMFYOA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |