C19H24N2O6S2 — CID 133165854
2-[(4-methoxyphenyl)sulfonyl-methylamino]-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide (PubChem CID 133165854) has the molecular formula C19H24N2O6S2 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)sulfonyl-methylamino]-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide.
| Compound Name | 2-[(4-methoxyphenyl)sulfonyl-methylamino]-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 133165854 |
| Molecular Formula | C19H24N2O6S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-[(4-methoxyphenyl)sulfonyl-methylamino]-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(=O)NC(C)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H24N2O6S2/c1-14(15-5-9-17(10-6-15)28(4,23)24)20-19(22)13-21(2)29(25,26)18-11-7-16(27-3)8-12-18/h5-12,14H,13H2,1-4H3,(H,20,22) |
| InChIKey | XSHKIAJCKONZGB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |