C21H25FN2O5S2 — CID 133165865
1-(4-fluorophenyl)sulfonyl-N-[1-(4-methylsulfonylphenyl)ethyl]piperidine-3-carboxamide (PubChem CID 133165865) has the molecular formula C21H25FN2O5S2 and a molecular weight of 468.57 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-[1-(4-methylsulfonylphenyl)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-[1-(4-methylsulfonylphenyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133165865 |
| Molecular Formula | C21H25FN2O5S2 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-[1-(4-methylsulfonylphenyl)ethyl]piperidine-3-carboxamide |
| SMILES | CC(NC(=O)C1CCCN(S(=O)(=O)c2ccc(F)cc2)C1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H25FN2O5S2/c1-15(16-5-9-19(10-6-16)30(2,26)27)23-21(25)17-4-3-13-24(14-17)31(28,29)20-11-7-18(22)8-12-20/h5-12,15,17H,3-4,13-14H2,1-2H3,(H,23,25) |
| InChIKey | OFGVHCZRTLJQGO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |