C20H26N2O4S — CID 133166033
N-[2-(2,5-dimethylphenoxy)ethyl]-2-(N-methylsulfonylanilino)propanamide (PubChem CID 133166033) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-[2-(2,5-dimethylphenoxy)ethyl]-2-(N-methylsulfonylanilino)propanamide.
| Compound Name | N-[2-(2,5-dimethylphenoxy)ethyl]-2-(N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 133166033 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[2-(2,5-dimethylphenoxy)ethyl]-2-(N-methylsulfonylanilino)propanamide |
| SMILES | Cc1ccc(C)c(OCCNC(=O)C(C)N(c2ccccc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H26N2O4S/c1-15-10-11-16(2)19(14-15)26-13-12-21-20(23)17(3)22(27(4,24)25)18-8-6-5-7-9-18/h5-11,14,17H,12-13H2,1-4H3,(H,21,23) |
| InChIKey | GKIJQNUAVPOCBJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|