C23H30N2O2 — CID 133166851
2-(2,3-dimethylphenoxy)-N-(4-piperidin-1-ylphenyl)butanamide (PubChem CID 133166851) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-(4-piperidin-1-ylphenyl)butanamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-(4-piperidin-1-ylphenyl)butanamide |
|---|---|
| PubChem CID | 133166851 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-(4-piperidin-1-ylphenyl)butanamide |
| SMILES | CCC(Oc1cccc(C)c1C)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H30N2O2/c1-4-21(27-22-10-8-9-17(2)18(22)3)23(26)24-19-11-13-20(14-12-19)25-15-6-5-7-16-25/h8-14,21H,4-7,15-16H2,1-3H3,(H,24,26) |
| InChIKey | GZUUOZRYDUWSBG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|