C23H30N2O6S — CID 133167682
N-[1-(4-methoxyphenoxy)propan-2-yl]-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 133167682) has the molecular formula C23H30N2O6S and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[1-(4-methoxyphenoxy)propan-2-yl]-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[1-(4-methoxyphenoxy)propan-2-yl]-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 133167682 |
| Molecular Formula | C23H30N2O6S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-[1-(4-methoxyphenoxy)propan-2-yl]-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COc1ccc(OCC(C)NC(=O)C2CCN(S(=O)(=O)c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H30N2O6S/c1-17(16-31-21-6-4-19(29-2)5-7-21)24-23(26)18-12-14-25(15-13-18)32(27,28)22-10-8-20(30-3)9-11-22/h4-11,17-18H,12-16H2,1-3H3,(H,24,26) |
| InChIKey | ZNXUDTMAJJCMHH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |