C23H24N2O3 — CID 133169592
N-[(E)-(2-ethoxynaphthalen-1-yl)methylideneamino]-4-propoxybenzamide (PubChem CID 133169592) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[(E)-(2-ethoxynaphthalen-1-yl)methylideneamino]-4-propoxybenzamide.
| Compound Name | N-[(E)-(2-ethoxynaphthalen-1-yl)methylideneamino]-4-propoxybenzamide |
|---|---|
| PubChem CID | 133169592 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(E)-(2-ethoxynaphthalen-1-yl)methylideneamino]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2c(OCC)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-3-15-28-19-12-9-18(10-13-19)23(26)25-24-16-21-20-8-6-5-7-17(20)11-14-22(21)27-4-2/h5-14,16H,3-4,15H2,1-2H3,(H,25,26)/b24-16+ |
| InChIKey | BCGVOZFWVROZOU-LFVJCYFKSA-N |
| XLogP | 4.79 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|