About 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride
3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride (PubChem CID 13317) has the molecular formula C19H23ClFNS
and a molecular weight of 351.92 g/mol. Its IUPAC name is 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride.
Molecular Properties
| Compound Name | 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride |
| PubChem CID | 13317 |
| Molecular Formula | C19H23ClFNS |
| Molecular Weight | 351.92 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride |
| SMILES | C[NH+](C)CCCC1c2ccccc2CSc2ccc(F)cc21.[Cl-] |
| InChI | InChI=1S/C19H22FNS.ClH/c1-21(2)11-5-8-17-16-7-4-3-6-14(16)13-22-19-10-9-15(20)12-18(17)19;/h3-4,6-7,9-10,12,17H,5,8,11,13H2,1-2H3;1H |
| InChIKey | NUZHVTZQUNKCSZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.92 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride?
The IUPAC name of 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride (CID 13317) is 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride.
What is the SMILES notation for 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride?
The canonical SMILES for 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride is C[NH+](C)CCCC1c2ccccc2CSc2ccc(F)cc21.[Cl-].
What is the InChIKey of 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride?
The InChIKey is NUZHVTZQUNKCSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22FNS.ClH/c1-21(2)11-5-8-17-16-7-4-3-6-14(16)13-22-19-10-9-15(20)12-18(17)19;/h3-4,6-7,9-10,12,17H,5,8,11,13H2,1-2H3;1H.
What are the key properties of 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride?
3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride has a molecular weight of 351.92 g/mol, XLogP of 0.49, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)propyl-dimethylazanium chloride is sourced from PubChem (CID 13317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).