C25H29BrCl3N3O4S — CID 133175126
2-[(3-bromophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylpropanamide (PubChem CID 133175126) has the molecular formula C25H29BrCl3N3O4S and a molecular weight of 653.85 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 133175126 |
| Molecular Formula | C25H29BrCl3N3O4S |
| Molecular Weight | 653.85 g/mol |
| Exact Mass | 651.01 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexylpropanamide |
| SMILES | CC(C(=O)NC1CCCCC1)N(Cc1cccc(Br)c1)C(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C25H29BrCl3N3O4S/c1-16(25(34)30-19-9-4-3-5-10-19)31(14-17-7-6-8-18(26)11-17)24(33)15-32(37(2,35)36)23-13-21(28)20(27)12-22(23)29/h6-8,11-13,16,19H,3-5,9-10,14-15H2,1-2H3,(H,30,34) |
| InChIKey | OXDLCZPQLWNYGA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.85 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|