C31H35BrN2O3 — CID 133175724
2-[benzyl-[2-(4-bromo-3-methylphenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 133175724) has the molecular formula C31H35BrN2O3 and a molecular weight of 563.54 g/mol. Its IUPAC name is 2-[benzyl-[2-(4-bromo-3-methylphenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | 2-[benzyl-[2-(4-bromo-3-methylphenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133175724 |
| Molecular Formula | C31H35BrN2O3 |
| Molecular Weight | 563.54 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 2-[benzyl-[2-(4-bromo-3-methylphenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | Cc1cc(OCC(=O)N(Cc2ccccc2)C(Cc2ccccc2)C(=O)NC2CCCCC2)ccc1Br |
| InChI | InChI=1S/C31H35BrN2O3/c1-23-19-27(17-18-28(23)32)37-22-30(35)34(21-25-13-7-3-8-14-25)29(20-24-11-5-2-6-12-24)31(36)33-26-15-9-4-10-16-26/h2-3,5-8,11-14,17-19,26,29H,4,9-10,15-16,20-22H2,1H3,(H,33,36) |
| InChIKey | QLFCJKHDDICRNX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |