C18H26O — CID 13317780
(4aS,10aS)-7-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthrene (PubChem CID 13317780) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is (4aS,10aS)-7-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthrene.
| Compound Name | (4aS,10aS)-7-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthrene |
|---|---|
| PubChem CID | 13317780 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (4aS,10aS)-7-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthrene |
| SMILES | COc1ccc2c(c1)CC[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C18H26O/c1-17(2)10-5-11-18(3)15-8-7-14(19-4)12-13(15)6-9-16(17)18/h7-8,12,16H,5-6,9-11H2,1-4H3/t16-,18+/m0/s1 |
| InChIKey | ALLOQDUBHKSUOV-FUHWJXTLSA-N |
| XLogP | 4.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |