About 3-methylbut-2-enal
3-methylbut-2-enal (PubChem CID 13317832) has the molecular formula C5H7O+
and a molecular weight of 83.11 g/mol. Its IUPAC name is 3-methylbut-2-enal.
Molecular Properties
| Compound Name | 3-methylbut-2-enal |
| PubChem CID | 13317832 |
| Molecular Formula | C5H7O+ |
| Molecular Weight | 83.11 g/mol |
| Exact Mass | 83.05 |
| IUPAC Name | 3-methylbut-2-enal |
| SMILES | CC(C)=[C+]C=O |
| InChI | InChI=1S/C5H7O/c1-5(2)3-4-6/h4H,1-2H3/q+1 |
| InChIKey | REVXWCCMLBUJES-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 83.11 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enal?
The IUPAC name of 3-methylbut-2-enal (CID 13317832) is 3-methylbut-2-enal.
What is the SMILES notation for 3-methylbut-2-enal?
The canonical SMILES for 3-methylbut-2-enal is CC(C)=[C+]C=O.
What is the InChIKey of 3-methylbut-2-enal?
The InChIKey is REVXWCCMLBUJES-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7O/c1-5(2)3-4-6/h4H,1-2H3/q+1.
What are the key properties of 3-methylbut-2-enal?
3-methylbut-2-enal has a molecular weight of 83.11 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enal is sourced from PubChem (CID 13317832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).