About 5-iodospiro[3H-1-benzofuran-2,4'-piperidine]
5-iodospiro[3H-1-benzofuran-2,4'-piperidine] (PubChem CID 13318076) has the molecular formula C12H14INO
and a molecular weight of 315.15 g/mol. Its IUPAC name is 5-iodospiro[3H-1-benzofuran-2,4'-piperidine].
Molecular Properties
| Compound Name | 5-iodospiro[3H-1-benzofuran-2,4'-piperidine] |
| PubChem CID | 13318076 |
| Molecular Formula | C12H14INO |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 5-iodospiro[3H-1-benzofuran-2,4'-piperidine] |
| SMILES | Ic1ccc2c(c1)CC1(CCNCC1)O2 |
| InChI | InChI=1S/C12H14INO/c13-10-1-2-11-9(7-10)8-12(15-11)3-5-14-6-4-12/h1-2,7,14H,3-6,8H2 |
| InChIKey | MOMCHFYUVYRWCE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodospiro[3H-1-benzofuran-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodospiro[3H-1-benzofuran-2,4'-piperidine]?
The IUPAC name of 5-iodospiro[3H-1-benzofuran-2,4'-piperidine] (CID 13318076) is 5-iodospiro[3H-1-benzofuran-2,4'-piperidine].
What is the SMILES notation for 5-iodospiro[3H-1-benzofuran-2,4'-piperidine]?
The canonical SMILES for 5-iodospiro[3H-1-benzofuran-2,4'-piperidine] is Ic1ccc2c(c1)CC1(CCNCC1)O2.
What is the InChIKey of 5-iodospiro[3H-1-benzofuran-2,4'-piperidine]?
The InChIKey is MOMCHFYUVYRWCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14INO/c13-10-1-2-11-9(7-10)8-12(15-11)3-5-14-6-4-12/h1-2,7,14H,3-6,8H2.
What are the key properties of 5-iodospiro[3H-1-benzofuran-2,4'-piperidine]?
5-iodospiro[3H-1-benzofuran-2,4'-piperidine] has a molecular weight of 315.15 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodospiro[3H-1-benzofuran-2,4'-piperidine] is sourced from PubChem (CID 13318076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).