C23H27N5OS — CID 133181407
5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-1-(pyridin-3-ylmethyl)imidazolidine-2-thione (PubChem CID 133181407) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is 5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-1-(pyridin-3-ylmethyl)imidazolidine-2-thione.
| Compound Name | 5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-1-(pyridin-3-ylmethyl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 133181407 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 5-[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-1-(pyridin-3-ylmethyl)imidazolidine-2-thione |
| SMILES | COCCn1c(C)cc(C2C(c3ccccn3)NC(=S)N2Cc2cccnc2)c1C |
| InChI | InChI=1S/C23H27N5OS/c1-16-13-19(17(2)27(16)11-12-29-3)22-21(20-8-4-5-10-25-20)26-23(30)28(22)15-18-7-6-9-24-14-18/h4-10,13-14,21-22H,11-12,15H2,1-3H3,(H,26,30) |
| InChIKey | SDGCJJZAJCZYTI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|