C29H28N4O2S — CID 133183367
5-[1-(oxolan-2-ylmethyl)pyrrol-2-yl]-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183367) has the molecular formula C29H28N4O2S and a molecular weight of 496.64 g/mol. Its IUPAC name is 5-[1-(oxolan-2-ylmethyl)pyrrol-2-yl]-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(oxolan-2-ylmethyl)pyrrol-2-yl]-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183367 |
| Molecular Formula | C29H28N4O2S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 5-[1-(oxolan-2-ylmethyl)pyrrol-2-yl]-1-(4-phenoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2cccn2CC2CCCO2)N1c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H28N4O2S/c36-29-31-27(25-11-4-5-17-30-25)28(26-12-6-18-32(26)20-24-10-7-19-34-24)33(29)21-13-15-23(16-14-21)35-22-8-2-1-3-9-22/h1-6,8-9,11-18,24,27-28H,7,10,19-20H2,(H,31,36) |
| InChIKey | CLJDVRJIVAAUIG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|