C20H23ClN2O4 — CID 133186114
4-chloro-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]-3-nitrobenzamide (PubChem CID 133186114) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is 4-chloro-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 133186114 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 4-chloro-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]-3-nitrobenzamide |
| SMILES | COc1cc(C)c(C(C)NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)cc1C(C)C |
| InChI | InChI=1S/C20H23ClN2O4/c1-11(2)15-10-16(12(3)8-19(15)27-5)13(4)22-20(24)14-6-7-17(21)18(9-14)23(25)26/h6-11,13H,1-5H3,(H,22,24) |
| InChIKey | UHFWSPXSDHCEEZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|