C20H26INO4S — CID 133186440
3-iodo-4-methoxy-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]benzenesulfonamide (PubChem CID 133186440) has the molecular formula C20H26INO4S and a molecular weight of 503.40 g/mol. Its IUPAC name is 3-iodo-4-methoxy-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 3-iodo-4-methoxy-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 133186440 |
| Molecular Formula | C20H26INO4S |
| Molecular Weight | 503.40 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | 3-iodo-4-methoxy-N-[1-(4-methoxy-2-methyl-5-propan-2-ylphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)c2cc(C(C)C)c(OC)cc2C)cc1I |
| InChI | InChI=1S/C20H26INO4S/c1-12(2)16-11-17(13(3)9-20(16)26-6)14(4)22-27(23,24)15-7-8-19(25-5)18(21)10-15/h7-12,14,22H,1-6H3 |
| InChIKey | ONIKTPMRPIEMPK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|