About 5-amino-1,5-dihydroimidazol-2-one
5-amino-1,5-dihydroimidazol-2-one (PubChem CID 13318649) has the molecular formula C3H5N3O
and a molecular weight of 99.09 g/mol. Its IUPAC name is 5-amino-1,5-dihydroimidazol-2-one.
Molecular Properties
| Compound Name | 5-amino-1,5-dihydroimidazol-2-one |
|---|
| PubChem CID | 13318649 |
|---|
| Molecular Formula | C3H5N3O |
|---|
| Molecular Weight | 99.09 g/mol |
|---|
| Exact Mass | 99.04 |
|---|
| IUPAC Name | 5-amino-1,5-dihydroimidazol-2-one |
|---|
| SMILES | NC1C=NC(=O)N1 |
|---|
| InChI | InChI=1S/C3H5N3O/c4-2-1-5-3(7)6-2/h1-2H,4H2,(H,6,7) |
|---|
| InChIKey | MCHWURRNYBKORF-UHFFFAOYSA-N |
|---|
| XLogP | -0.93 |
|---|
| TPSA | 67.48 Ų |
|---|
| H-Bond Donors | 2 |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 7 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-amino-1,5-dihydroimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,5-dihydroimidazol-2-one?
The IUPAC name of 5-amino-1,5-dihydroimidazol-2-one (CID 13318649) is 5-amino-1,5-dihydroimidazol-2-one.
What is the SMILES notation for 5-amino-1,5-dihydroimidazol-2-one?
The canonical SMILES for 5-amino-1,5-dihydroimidazol-2-one is NC1C=NC(=O)N1.
What is the InChIKey of 5-amino-1,5-dihydroimidazol-2-one?
The InChIKey is MCHWURRNYBKORF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O/c4-2-1-5-3(7)6-2/h1-2H,4H2,(H,6,7).
What are the key properties of 5-amino-1,5-dihydroimidazol-2-one?
5-amino-1,5-dihydroimidazol-2-one has a molecular weight of 99.09 g/mol, XLogP of -0.93, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,5-dihydroimidazol-2-one is sourced from PubChem (CID 13318649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).