About 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole
2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole (PubChem CID 13318658) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 13318658 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole |
| SMILES | C=CCOC1(C2=NCCN2)COc2ccccc2O1 |
| InChI | InChI=1S/C14H16N2O3/c1-2-9-18-14(13-15-7-8-16-13)10-17-11-5-3-4-6-12(11)19-14/h2-6H,1,7-10H2,(H,15,16) |
| InChIKey | FPVVPRXEQBJFKY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole (CID 13318658) is 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole is C=CCOC1(C2=NCCN2)COc2ccccc2O1.
What is the InChIKey of 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole?
The InChIKey is FPVVPRXEQBJFKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-2-9-18-14(13-15-7-8-16-13)10-17-11-5-3-4-6-12(11)19-14/h2-6H,1,7-10H2,(H,15,16).
What are the key properties of 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole?
2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole has a molecular weight of 260.29 g/mol, XLogP of 1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-prop-2-enoxy-2H-1,4-benzodioxin-3-yl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 13318658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).