C15H20Br2O3S — CID 133188506
4,4-dibromo-3-(hex-5-enoxymethyl)-3-methyl-2H-thieno[3,4-b][1,4]dioxepine (PubChem CID 133188506) has the molecular formula C15H20Br2O3S and a molecular weight of 440.20 g/mol. Its IUPAC name is 4,4-dibromo-3-(hex-5-enoxymethyl)-3-methyl-2H-thieno[3,4-b][1,4]dioxepine.
| Compound Name | 4,4-dibromo-3-(hex-5-enoxymethyl)-3-methyl-2H-thieno[3,4-b][1,4]dioxepine |
|---|---|
| PubChem CID | 133188506 |
| Molecular Formula | C15H20Br2O3S |
| Molecular Weight | 440.20 g/mol |
| Exact Mass | 437.95 |
| IUPAC Name | 4,4-dibromo-3-(hex-5-enoxymethyl)-3-methyl-2H-thieno[3,4-b][1,4]dioxepine |
| SMILES | C=CCCCCOCC1(C)COc2cscc2OC1(Br)Br |
| InChI | InChI=1S/C15H20Br2O3S/c1-3-4-5-6-7-18-10-14(2)11-19-12-8-21-9-13(12)20-15(14,16)17/h3,8-9H,1,4-7,10-11H2,2H3 |
| InChIKey | YNZMWXRCFYBAOR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.20 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|