C3H6N10 — CID 133188548
5-imino-1-(2H-tetrazol-5-yl)-1,2,4-triazole-3,4-diamine (PubChem CID 133188548) has the molecular formula C3H6N10 and a molecular weight of 182.15 g/mol. Its IUPAC name is 5-imino-1-(2H-tetrazol-5-yl)-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-imino-1-(2H-tetrazol-5-yl)-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 133188548 |
| Molecular Formula | C3H6N10 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 5-imino-1-(2H-tetrazol-5-yl)-1,2,4-triazole-3,4-diamine |
| SMILES | [H]/N=c1/n(-c2nn[nH]n2)nc(N)n1N |
| InChI | InChI=1S/C3H6N10/c4-1-9-13(2(5)12(1)6)3-7-10-11-8-3/h5H,6H2,(H2,4,9)(H,7,8,10,11)/b5-2+ |
| InChIKey | IVNGUHISXULDEA-GORDUTHDSA-N |
| XLogP | -3.04 |
| TPSA | 153.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |