C21H25NO2 — CID 133188915
N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-(3-methylphenoxy)propanamide (PubChem CID 133188915) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-(3-methylphenoxy)propanamide.
| Compound Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-(3-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 133188915 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-2-(3-methylphenoxy)propanamide |
| SMILES | Cc1cccc(OC(C)C(=O)NC(C)c2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C21H25NO2/c1-14-6-4-9-20(12-14)24-16(3)21(23)22-15(2)18-11-10-17-7-5-8-19(17)13-18/h4,6,9-13,15-16H,5,7-8H2,1-3H3,(H,22,23) |
| InChIKey | AMRHYSNNVIQSGC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |