C17H20FNO4S2 — CID 133189853
4-fluoro-3-methyl-N-[1-(4-methylsulfonylphenyl)propyl]benzenesulfonamide (PubChem CID 133189853) has the molecular formula C17H20FNO4S2 and a molecular weight of 385.48 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[1-(4-methylsulfonylphenyl)propyl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-N-[1-(4-methylsulfonylphenyl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 133189853 |
| Molecular Formula | C17H20FNO4S2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 4-fluoro-3-methyl-N-[1-(4-methylsulfonylphenyl)propyl]benzenesulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(F)c(C)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H20FNO4S2/c1-4-17(13-5-7-14(8-6-13)24(3,20)21)19-25(22,23)15-9-10-16(18)12(2)11-15/h5-11,17,19H,4H2,1-3H3 |
| InChIKey | XALRYNXGCGNAJQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |