About 2-fluoropropanedioyl difluoride
2-fluoropropanedioyl difluoride (PubChem CID 13319075) has the molecular formula C3HF3O2
and a molecular weight of 126.03 g/mol. Its IUPAC name is 2-fluoropropanedioyl difluoride.
Molecular Properties
| Compound Name | 2-fluoropropanedioyl difluoride |
| PubChem CID | 13319075 |
| Molecular Formula | C3HF3O2 |
| Molecular Weight | 126.03 g/mol |
| Exact Mass | 125.99 |
| IUPAC Name | 2-fluoropropanedioyl difluoride |
| SMILES | O=C(F)C(F)C(=O)F |
| InChI | InChI=1S/C3HF3O2/c4-1(2(5)7)3(6)8/h1H |
| InChIKey | SQOBBFFEODAFEM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.03 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoropropanedioyl difluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoropropanedioyl difluoride?
The IUPAC name of 2-fluoropropanedioyl difluoride (CID 13319075) is 2-fluoropropanedioyl difluoride.
What is the SMILES notation for 2-fluoropropanedioyl difluoride?
The canonical SMILES for 2-fluoropropanedioyl difluoride is O=C(F)C(F)C(=O)F.
What is the InChIKey of 2-fluoropropanedioyl difluoride?
The InChIKey is SQOBBFFEODAFEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HF3O2/c4-1(2(5)7)3(6)8/h1H.
What are the key properties of 2-fluoropropanedioyl difluoride?
2-fluoropropanedioyl difluoride has a molecular weight of 126.03 g/mol, XLogP of 0.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoropropanedioyl difluoride is sourced from PubChem (CID 13319075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).