C6H7FN2O3 — CID 13319083
5-fluoro-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 13319083) has the molecular formula C6H7FN2O3 and a molecular weight of 174.13 g/mol. Its IUPAC name is 5-fluoro-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-fluoro-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 13319083 |
| Molecular Formula | C6H7FN2O3 |
| Molecular Weight | 174.13 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 5-fluoro-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(F)C(=O)N(C)C1=O |
| InChI | InChI=1S/C6H7FN2O3/c1-8-4(10)3(7)5(11)9(2)6(8)12/h3H,1-2H3 |
| InChIKey | ZPLZNRHNIZLPSE-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.13 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|