C19H21NO — CID 133191255
N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-4-methylbenzamide (PubChem CID 133191255) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-4-methylbenzamide.
| Compound Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 133191255 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[1-(2,3-dihydro-1H-inden-5-yl)ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(C)c2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C19H21NO/c1-13-6-8-16(9-7-13)19(21)20-14(2)17-11-10-15-4-3-5-18(15)12-17/h6-12,14H,3-5H2,1-2H3,(H,20,21) |
| InChIKey | DXZNXFHLLNWUQP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |