About [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium
[(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium (PubChem CID 13319245) has the molecular formula C9H20NO+
and a molecular weight of 158.27 g/mol. Its IUPAC name is [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium.
Molecular Properties
| Compound Name | [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium |
| PubChem CID | 13319245 |
| Molecular Formula | C9H20NO+ |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium |
| SMILES | C[N+](C)(C)[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C9H20NO/c1-10(2,3)8-6-4-5-7-9(8)11/h8-9,11H,4-7H2,1-3H3/q+1/t8-,9+/m1/s1 |
| InChIKey | YVFNMIFOQCYHSZ-BDAKNGLRSA-N |
| XLogP | 1.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium?
The IUPAC name of [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium (CID 13319245) is [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium.
What is the SMILES notation for [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium?
The canonical SMILES for [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium is C[N+](C)(C)[C@@H]1CCCC[C@@H]1O.
What is the InChIKey of [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium?
The InChIKey is YVFNMIFOQCYHSZ-BDAKNGLRSA-N. The full InChI is InChI=1S/C9H20NO/c1-10(2,3)8-6-4-5-7-9(8)11/h8-9,11H,4-7H2,1-3H3/q+1/t8-,9+/m1/s1.
What are the key properties of [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium?
[(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium has a molecular weight of 158.27 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-hydroxycyclohexyl]-trimethylazanium is sourced from PubChem (CID 13319245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).