C27H29ClN2O2 — CID 133192674
2-[(3-chlorophenyl)methyl-(2-phenylacetyl)amino]-3-phenyl-N-propan-2-ylpropanamide (PubChem CID 133192674) has the molecular formula C27H29ClN2O2 and a molecular weight of 448.99 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl-(2-phenylacetyl)amino]-3-phenyl-N-propan-2-ylpropanamide.
| Compound Name | 2-[(3-chlorophenyl)methyl-(2-phenylacetyl)amino]-3-phenyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 133192674 |
| Molecular Formula | C27H29ClN2O2 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl-(2-phenylacetyl)amino]-3-phenyl-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(Cc1ccccc1)N(Cc1cccc(Cl)c1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H29ClN2O2/c1-20(2)29-27(32)25(17-21-10-5-3-6-11-21)30(19-23-14-9-15-24(28)16-23)26(31)18-22-12-7-4-8-13-22/h3-16,20,25H,17-19H2,1-2H3,(H,29,32) |
| InChIKey | PZHFMSRRYFIZDT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |