C21H24BrClN2O3 — CID 133194635
2-[(3-bromophenyl)methyl-[2-(2-chlorophenoxy)acetyl]amino]-N-propan-2-ylpropanamide (PubChem CID 133194635) has the molecular formula C21H24BrClN2O3 and a molecular weight of 467.79 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(2-chlorophenoxy)acetyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(2-chlorophenoxy)acetyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 133194635 |
| Molecular Formula | C21H24BrClN2O3 |
| Molecular Weight | 467.79 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(2-chlorophenoxy)acetyl]amino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C21H24BrClN2O3/c1-14(2)24-21(27)15(3)25(12-16-7-6-8-17(22)11-16)20(26)13-28-19-10-5-4-9-18(19)23/h4-11,14-15H,12-13H2,1-3H3,(H,24,27) |
| InChIKey | OQTZGDPZVJYQKG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |