C10H6N2O — CID 13319525
8-oxa-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 13319525) has the molecular formula C10H6N2O and a molecular weight of 170.17 g/mol. Its IUPAC name is 8-oxa-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 8-oxa-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 13319525 |
| Molecular Formula | C10H6N2O |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 8-oxa-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | c1cnc2oc3ncccc3c2c1 |
| InChI | InChI=1S/C10H6N2O/c1-3-7-8-4-2-6-12-10(8)13-9(7)11-5-1/h1-6H |
| InChIKey | PGIPYQDSASEDRU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |