About 3-(oxiran-2-yl)pyridine
3-(oxiran-2-yl)pyridine (PubChem CID 13319561) has the molecular formula C7H7NO
and a molecular weight of 121.14 g/mol. Its IUPAC name is 3-(oxiran-2-yl)pyridine.
Molecular Properties
| Compound Name | 3-(oxiran-2-yl)pyridine |
| PubChem CID | 13319561 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 3-(oxiran-2-yl)pyridine |
| SMILES | c1cncc(C2CO2)c1 |
| InChI | InChI=1S/C7H7NO/c1-2-6(4-8-3-1)7-5-9-7/h1-4,7H,5H2 |
| InChIKey | QLGZSSLYMJHGRQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(oxiran-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxiran-2-yl)pyridine?
The IUPAC name of 3-(oxiran-2-yl)pyridine (CID 13319561) is 3-(oxiran-2-yl)pyridine.
What is the SMILES notation for 3-(oxiran-2-yl)pyridine?
The canonical SMILES for 3-(oxiran-2-yl)pyridine is c1cncc(C2CO2)c1.
What is the InChIKey of 3-(oxiran-2-yl)pyridine?
The InChIKey is QLGZSSLYMJHGRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO/c1-2-6(4-8-3-1)7-5-9-7/h1-4,7H,5H2.
What are the key properties of 3-(oxiran-2-yl)pyridine?
3-(oxiran-2-yl)pyridine has a molecular weight of 121.14 g/mol, XLogP of 1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxiran-2-yl)pyridine is sourced from PubChem (CID 13319561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).