C23H26BrClN2O2 — CID 133196382
2-[(4-bromophenyl)methyl-[2-(4-chlorophenyl)acetyl]amino]-N-cyclopentylpropanamide (PubChem CID 133196382) has the molecular formula C23H26BrClN2O2 and a molecular weight of 477.83 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-(4-chlorophenyl)acetyl]amino]-N-cyclopentylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-(4-chlorophenyl)acetyl]amino]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 133196382 |
| Molecular Formula | C23H26BrClN2O2 |
| Molecular Weight | 477.83 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-(4-chlorophenyl)acetyl]amino]-N-cyclopentylpropanamide |
| SMILES | CC(C(=O)NC1CCCC1)N(Cc1ccc(Br)cc1)C(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26BrClN2O2/c1-16(23(29)26-21-4-2-3-5-21)27(15-18-6-10-19(24)11-7-18)22(28)14-17-8-12-20(25)13-9-17/h6-13,16,21H,2-5,14-15H2,1H3,(H,26,29) |
| InChIKey | LYVZNMVCHBSPFK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.83 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |