C20H31N3O2 — CID 13319688
3-[2-[di(propan-2-yl)amino]ethyl]-4,4-dimethyl-3-pyridin-2-ylpiperidine-2,6-dione (PubChem CID 13319688) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 3-[2-[di(propan-2-yl)amino]ethyl]-4,4-dimethyl-3-pyridin-2-ylpiperidine-2,6-dione.
| Compound Name | 3-[2-[di(propan-2-yl)amino]ethyl]-4,4-dimethyl-3-pyridin-2-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 13319688 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 3-[2-[di(propan-2-yl)amino]ethyl]-4,4-dimethyl-3-pyridin-2-ylpiperidine-2,6-dione |
| SMILES | CC(C)N(CCC1(c2ccccn2)C(=O)NC(=O)CC1(C)C)C(C)C |
| InChI | InChI=1S/C20H31N3O2/c1-14(2)23(15(3)4)12-10-20(16-9-7-8-11-21-16)18(25)22-17(24)13-19(20,5)6/h7-9,11,14-15H,10,12-13H2,1-6H3,(H,22,24,25) |
| InChIKey | XAMGWVXHVOLSRF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|