C14H17ClFNO2S — CID 133200042
2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 133200042) has the molecular formula C14H17ClFNO2S and a molecular weight of 317.81 g/mol. Its IUPAC name is 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 133200042 |
| Molecular Formula | C14H17ClFNO2S |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(CSCc1ccc(Cl)cc1F)NCC1CCCO1 |
| InChI | InChI=1S/C14H17ClFNO2S/c15-11-4-3-10(13(16)6-11)8-20-9-14(18)17-7-12-2-1-5-19-12/h3-4,6,12H,1-2,5,7-9H2,(H,17,18) |
| InChIKey | ISOJOQGRMWVWFS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |